C17H32N4 — CID 121329503
N-[(Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 121329503) has the molecular formula C17H32N4 and a molecular weight of 292.47 g/mol. Its IUPAC name is N-[(Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[(Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 121329503 |
| Molecular Formula | C17H32N4 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | N-[(Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNCC/C=C\N1CN=C(C)C=C1C |
| InChI | InChI=1S/C17H32N4/c1-5-20(6-2)12-9-11-18-10-7-8-13-21-15-19-16(3)14-17(21)4/h8,13-14,18H,5-7,9-12,15H2,1-4H3/b13-8- |
| InChIKey | RVNWSQBBLJLPDA-JYRVWZFOSA-N |
| XLogP | 2.85 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|