About (Z)-4-[(2S)-2,4,6-trimethyl-2H-pyrimidin-1-yl]but-3-enamide
(Z)-4-[(2S)-2,4,6-trimethyl-2H-pyrimidin-1-yl]but-3-enamide (PubChem CID 121330183) has the molecular formula C11H17N3O
and a molecular weight of 207.28 g/mol. Its IUPAC name is (Z)-4-[(2S)-2,4,6-trimethyl-2H-pyrimidin-1-yl]but-3-enamide.
Molecular Properties
| Compound Name | (Z)-4-[(2S)-2,4,6-trimethyl-2H-pyrimidin-1-yl]but-3-enamide |
| PubChem CID | 121330183 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (Z)-4-[(2S)-2,4,6-trimethyl-2H-pyrimidin-1-yl]but-3-enamide |
| SMILES | CC1=CC(C)=N[C@@H](C)N1/C=C\CC(N)=O |
| InChI | InChI=1S/C11H17N3O/c1-8-7-9(2)14(10(3)13-8)6-4-5-11(12)15/h4,6-7,10H,5H2,1-3H3,(H2,12,15)/b6-4-/t10-/m1/s1 |
| InChIKey | IVOFNNNFJRYHKY-AYYIZTPMSA-N |
| XLogP | 1.40 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-4-[(2S)-2,4,6-trimethyl-2H-pyrimidin-1-yl]but-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-[(2S)-2,4,6-trimethyl-2H-pyrimidin-1-yl]but-3-enamide?
The IUPAC name of (Z)-4-[(2S)-2,4,6-trimethyl-2H-pyrimidin-1-yl]but-3-enamide (CID 121330183) is (Z)-4-[(2S)-2,4,6-trimethyl-2H-pyrimidin-1-yl]but-3-enamide.
What is the SMILES notation for (Z)-4-[(2S)-2,4,6-trimethyl-2H-pyrimidin-1-yl]but-3-enamide?
The canonical SMILES for (Z)-4-[(2S)-2,4,6-trimethyl-2H-pyrimidin-1-yl]but-3-enamide is CC1=CC(C)=N[C@@H](C)N1/C=C\CC(N)=O.
What is the InChIKey of (Z)-4-[(2S)-2,4,6-trimethyl-2H-pyrimidin-1-yl]but-3-enamide?
The InChIKey is IVOFNNNFJRYHKY-AYYIZTPMSA-N. The full InChI is InChI=1S/C11H17N3O/c1-8-7-9(2)14(10(3)13-8)6-4-5-11(12)15/h4,6-7,10H,5H2,1-3H3,(H2,12,15)/b6-4-/t10-/m1/s1.
What are the key properties of (Z)-4-[(2S)-2,4,6-trimethyl-2H-pyrimidin-1-yl]but-3-enamide?
(Z)-4-[(2S)-2,4,6-trimethyl-2H-pyrimidin-1-yl]but-3-enamide has a molecular weight of 207.28 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-[(2S)-2,4,6-trimethyl-2H-pyrimidin-1-yl]but-3-enamide is sourced from PubChem (CID 121330183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).