About (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)-N-propan-2-ylacetamide
(2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)-N-propan-2-ylacetamide (PubChem CID 121330191) has the molecular formula C11H17N3O
and a molecular weight of 207.28 g/mol. Its IUPAC name is (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)-N-propan-2-ylacetamide |
| PubChem CID | 121330191 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)-N-propan-2-ylacetamide |
| SMILES | CC1=CC(C)=N/C(=C\C(=O)NC(C)C)N1 |
| InChI | InChI=1S/C11H17N3O/c1-7(2)12-11(15)6-10-13-8(3)5-9(4)14-10/h5-7,13H,1-4H3,(H,12,15)/b10-6- |
| InChIKey | CCMZSHGIUDPDDH-POHAHGRESA-N |
| XLogP | 1.32 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)-N-propan-2-ylacetamide?
The IUPAC name of (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)-N-propan-2-ylacetamide (CID 121330191) is (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)-N-propan-2-ylacetamide.
What is the SMILES notation for (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)-N-propan-2-ylacetamide?
The canonical SMILES for (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)-N-propan-2-ylacetamide is CC1=CC(C)=N/C(=C\C(=O)NC(C)C)N1.
What is the InChIKey of (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)-N-propan-2-ylacetamide?
The InChIKey is CCMZSHGIUDPDDH-POHAHGRESA-N. The full InChI is InChI=1S/C11H17N3O/c1-7(2)12-11(15)6-10-13-8(3)5-9(4)14-10/h5-7,13H,1-4H3,(H,12,15)/b10-6-.
What are the key properties of (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)-N-propan-2-ylacetamide?
(2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)-N-propan-2-ylacetamide has a molecular weight of 207.28 g/mol, XLogP of 1.32, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)-N-propan-2-ylacetamide is sourced from PubChem (CID 121330191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).