C15H24FN3 — CID 121330273
(E)-N-but-3-en-2-yl-4-fluoro-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-en-1-amine (PubChem CID 121330273) has the molecular formula C15H24FN3 and a molecular weight of 265.38 g/mol. Its IUPAC name is (E)-N-but-3-en-2-yl-4-fluoro-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-en-1-amine.
| Compound Name | (E)-N-but-3-en-2-yl-4-fluoro-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-en-1-amine |
|---|---|
| PubChem CID | 121330273 |
| Molecular Formula | C15H24FN3 |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | (E)-N-but-3-en-2-yl-4-fluoro-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-en-1-amine |
| SMILES | C=CC(C)NCC/C=C(/F)N1C(C)=CC(C)=NC1C |
| InChI | InChI=1S/C15H24FN3/c1-6-11(2)17-9-7-8-15(16)19-13(4)10-12(3)18-14(19)5/h6,8,10-11,14,17H,1,7,9H2,2-5H3/b15-8- |
| InChIKey | WTZMLMHRCKSWTM-NVNXTCNLSA-N |
| XLogP | 3.38 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|