About (Z)-N-butyl-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enamide
(Z)-N-butyl-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enamide (PubChem CID 121330300) has the molecular formula C14H23N3O
and a molecular weight of 249.36 g/mol. Its IUPAC name is (Z)-N-butyl-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enamide.
Molecular Properties
| Compound Name | (Z)-N-butyl-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enamide |
| PubChem CID | 121330300 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | (Z)-N-butyl-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enamide |
| SMILES | CCCCNC(=O)C/C=C\N1CN=C(C)C=C1C |
| InChI | InChI=1S/C14H23N3O/c1-4-5-8-15-14(18)7-6-9-17-11-16-12(2)10-13(17)3/h6,9-10H,4-5,7-8,11H2,1-3H3,(H,15,18)/b9-6- |
| InChIKey | LCZWPXOBNSGWAE-TWGQIWQCSA-N |
| XLogP | 2.44 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-butyl-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-butyl-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enamide?
The IUPAC name of (Z)-N-butyl-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enamide (CID 121330300) is (Z)-N-butyl-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enamide.
What is the SMILES notation for (Z)-N-butyl-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enamide?
The canonical SMILES for (Z)-N-butyl-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enamide is CCCCNC(=O)C/C=C\N1CN=C(C)C=C1C.
What is the InChIKey of (Z)-N-butyl-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enamide?
The InChIKey is LCZWPXOBNSGWAE-TWGQIWQCSA-N. The full InChI is InChI=1S/C14H23N3O/c1-4-5-8-15-14(18)7-6-9-17-11-16-12(2)10-13(17)3/h6,9-10H,4-5,7-8,11H2,1-3H3,(H,15,18)/b9-6-.
What are the key properties of (Z)-N-butyl-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enamide?
(Z)-N-butyl-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enamide has a molecular weight of 249.36 g/mol, XLogP of 2.44, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-butyl-4-(4,6-dimethyl-2H-pyrimidin-1-yl)but-3-enamide is sourced from PubChem (CID 121330300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).