About (Z)-4-imino-N,N-dimethylpent-2-en-2-amine
(Z)-4-imino-N,N-dimethylpent-2-en-2-amine (PubChem CID 121330310) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is (Z)-4-imino-N,N-dimethylpent-2-en-2-amine.
Molecular Properties
| Compound Name | (Z)-4-imino-N,N-dimethylpent-2-en-2-amine |
| PubChem CID | 121330310 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (Z)-4-imino-N,N-dimethylpent-2-en-2-amine |
| SMILES | [H]/N=C(C)/C=C(/C)N(C)C |
| InChI | InChI=1S/C7H14N2/c1-6(8)5-7(2)9(3)4/h5,8H,1-4H3/b7-5-,8-6+ |
| InChIKey | WSIVCAFBUNVZHN-CGXWXWIYSA-N |
| XLogP | 1.49 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-imino-N,N-dimethylpent-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-imino-N,N-dimethylpent-2-en-2-amine?
The IUPAC name of (Z)-4-imino-N,N-dimethylpent-2-en-2-amine (CID 121330310) is (Z)-4-imino-N,N-dimethylpent-2-en-2-amine.
What is the SMILES notation for (Z)-4-imino-N,N-dimethylpent-2-en-2-amine?
The canonical SMILES for (Z)-4-imino-N,N-dimethylpent-2-en-2-amine is [H]/N=C(C)/C=C(/C)N(C)C.
What is the InChIKey of (Z)-4-imino-N,N-dimethylpent-2-en-2-amine?
The InChIKey is WSIVCAFBUNVZHN-CGXWXWIYSA-N. The full InChI is InChI=1S/C7H14N2/c1-6(8)5-7(2)9(3)4/h5,8H,1-4H3/b7-5-,8-6+.
What are the key properties of (Z)-4-imino-N,N-dimethylpent-2-en-2-amine?
(Z)-4-imino-N,N-dimethylpent-2-en-2-amine has a molecular weight of 126.20 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-imino-N,N-dimethylpent-2-en-2-amine is sourced from PubChem (CID 121330310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).