About (Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)-N-ethylbut-3-enamide
(Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)-N-ethylbut-3-enamide (PubChem CID 121330327) has the molecular formula C12H19N3O
and a molecular weight of 221.30 g/mol. Its IUPAC name is (Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)-N-ethylbut-3-enamide.
Molecular Properties
| Compound Name | (Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)-N-ethylbut-3-enamide |
| PubChem CID | 121330327 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | (Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)-N-ethylbut-3-enamide |
| SMILES | CCNC(=O)C/C=C\N1CN=C(C)C=C1C |
| InChI | InChI=1S/C12H19N3O/c1-4-13-12(16)6-5-7-15-9-14-10(2)8-11(15)3/h5,7-8H,4,6,9H2,1-3H3,(H,13,16)/b7-5- |
| InChIKey | PHKMWDDHTKACFE-ALCCZGGFSA-N |
| XLogP | 1.66 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)-N-ethylbut-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)-N-ethylbut-3-enamide?
The IUPAC name of (Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)-N-ethylbut-3-enamide (CID 121330327) is (Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)-N-ethylbut-3-enamide.
What is the SMILES notation for (Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)-N-ethylbut-3-enamide?
The canonical SMILES for (Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)-N-ethylbut-3-enamide is CCNC(=O)C/C=C\N1CN=C(C)C=C1C.
What is the InChIKey of (Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)-N-ethylbut-3-enamide?
The InChIKey is PHKMWDDHTKACFE-ALCCZGGFSA-N. The full InChI is InChI=1S/C12H19N3O/c1-4-13-12(16)6-5-7-15-9-14-10(2)8-11(15)3/h5,7-8H,4,6,9H2,1-3H3,(H,13,16)/b7-5-.
What are the key properties of (Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)-N-ethylbut-3-enamide?
(Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)-N-ethylbut-3-enamide has a molecular weight of 221.30 g/mol, XLogP of 1.66, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(4,6-dimethyl-2H-pyrimidin-1-yl)-N-ethylbut-3-enamide is sourced from PubChem (CID 121330327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).