About [3-(aminomethyl)cyclohexyl]methanamine;benzene-1,4-dicarboxamide
[3-(aminomethyl)cyclohexyl]methanamine;benzene-1,4-dicarboxamide (PubChem CID 121330510) has the molecular formula C16H26N4O2
and a molecular weight of 306.41 g/mol. Its IUPAC name is [3-(aminomethyl)cyclohexyl]methanamine;benzene-1,4-dicarboxamide.
Molecular Properties
| Compound Name | [3-(aminomethyl)cyclohexyl]methanamine;benzene-1,4-dicarboxamide |
| PubChem CID | 121330510 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | [3-(aminomethyl)cyclohexyl]methanamine;benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(N)=O)cc1.NCC1CCCC(CN)C1 |
| InChI | InChI=1S/C8H8N2O2.C8H18N2/c9-7(11)5-1-2-6(4-3-5)8(10)12;9-5-7-2-1-3-8(4-7)6-10/h1-4H,(H2,9,11)(H2,10,12);7-8H,1-6,9-10H2 |
| InChIKey | KIXBZFKSFFHEBZ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(aminomethyl)cyclohexyl]methanamine;benzene-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(aminomethyl)cyclohexyl]methanamine;benzene-1,4-dicarboxamide?
The IUPAC name of [3-(aminomethyl)cyclohexyl]methanamine;benzene-1,4-dicarboxamide (CID 121330510) is [3-(aminomethyl)cyclohexyl]methanamine;benzene-1,4-dicarboxamide.
What is the SMILES notation for [3-(aminomethyl)cyclohexyl]methanamine;benzene-1,4-dicarboxamide?
The canonical SMILES for [3-(aminomethyl)cyclohexyl]methanamine;benzene-1,4-dicarboxamide is NC(=O)c1ccc(C(N)=O)cc1.NCC1CCCC(CN)C1.
What is the InChIKey of [3-(aminomethyl)cyclohexyl]methanamine;benzene-1,4-dicarboxamide?
The InChIKey is KIXBZFKSFFHEBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2.C8H18N2/c9-7(11)5-1-2-6(4-3-5)8(10)12;9-5-7-2-1-3-8(4-7)6-10/h1-4H,(H2,9,11)(H2,10,12);7-8H,1-6,9-10H2.
What are the key properties of [3-(aminomethyl)cyclohexyl]methanamine;benzene-1,4-dicarboxamide?
[3-(aminomethyl)cyclohexyl]methanamine;benzene-1,4-dicarboxamide has a molecular weight of 306.41 g/mol, XLogP of 0.59, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(aminomethyl)cyclohexyl]methanamine;benzene-1,4-dicarboxamide is sourced from PubChem (CID 121330510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).