C29H25N7O2 — CID 121330593
5-[4-[5-[[2-(dimethylamino)phenyl]methyl]tetrazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione (PubChem CID 121330593) has the molecular formula C29H25N7O2 and a molecular weight of 503.57 g/mol. Its IUPAC name is 5-[4-[5-[[2-(dimethylamino)phenyl]methyl]tetrazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione.
| Compound Name | 5-[4-[5-[[2-(dimethylamino)phenyl]methyl]tetrazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 121330593 |
| Molecular Formula | C29H25N7O2 |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 5-[4-[5-[[2-(dimethylamino)phenyl]methyl]tetrazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
| SMILES | CN(C)c1ccccc1Cc1nnnn1-c1ccc(N2C(=O)CC(=O)Nc3c2ccc2ccccc32)cc1 |
| InChI | InChI=1S/C29H25N7O2/c1-34(2)24-10-6-4-8-20(24)17-26-31-32-33-36(26)22-14-12-21(13-15-22)35-25-16-11-19-7-3-5-9-23(19)29(25)30-27(37)18-28(35)38/h3-16H,17-18H2,1-2H3,(H,30,37) |
| InChIKey | RVYUCJBMQHVPFG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|