C31H23F3N4O2 — CID 121330595
5-[4-[2-[1-[4-(trifluoromethyl)phenyl]ethyl]imidazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione (PubChem CID 121330595) has the molecular formula C31H23F3N4O2 and a molecular weight of 540.55 g/mol. Its IUPAC name is 5-[4-[2-[1-[4-(trifluoromethyl)phenyl]ethyl]imidazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione.
| Compound Name | 5-[4-[2-[1-[4-(trifluoromethyl)phenyl]ethyl]imidazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 121330595 |
| Molecular Formula | C31H23F3N4O2 |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 5-[4-[2-[1-[4-(trifluoromethyl)phenyl]ethyl]imidazol-1-yl]phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
| SMILES | CC(c1ccc(C(F)(F)F)cc1)c1nccn1-c1ccc(N2C(=O)CC(=O)Nc3c2ccc2ccccc32)cc1 |
| InChI | InChI=1S/C31H23F3N4O2/c1-19(20-6-9-22(10-7-20)31(32,33)34)30-35-16-17-37(30)23-11-13-24(14-12-23)38-26-15-8-21-4-2-3-5-25(21)29(26)36-27(39)18-28(38)40/h2-17,19H,18H2,1H3,(H,36,39) |
| InChIKey | VMYNSRGWIPRZSY-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|