C29H25FN4O2 — CID 121330709
5-[4-[2-[2-(2-fluorophenyl)ethyl]imidazol-1-yl]phenyl]-1,8,9,10-tetrahydrocyclopenta[i][1,5]benzodiazepine-2,4-dione (PubChem CID 121330709) has the molecular formula C29H25FN4O2 and a molecular weight of 480.54 g/mol. Its IUPAC name is 5-[4-[2-[2-(2-fluorophenyl)ethyl]imidazol-1-yl]phenyl]-1,8,9,10-tetrahydrocyclopenta[i][1,5]benzodiazepine-2,4-dione.
| Compound Name | 5-[4-[2-[2-(2-fluorophenyl)ethyl]imidazol-1-yl]phenyl]-1,8,9,10-tetrahydrocyclopenta[i][1,5]benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 121330709 |
| Molecular Formula | C29H25FN4O2 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 5-[4-[2-[2-(2-fluorophenyl)ethyl]imidazol-1-yl]phenyl]-1,8,9,10-tetrahydrocyclopenta[i][1,5]benzodiazepine-2,4-dione |
| SMILES | O=C1CC(=O)N(c2ccc(-n3ccnc3CCc3ccccc3F)cc2)c2ccc3c(c2N1)CCC3 |
| InChI | InChI=1S/C29H25FN4O2/c30-24-7-2-1-4-20(24)9-15-26-31-16-17-33(26)21-10-12-22(13-11-21)34-25-14-8-19-5-3-6-23(19)29(25)32-27(35)18-28(34)36/h1-2,4,7-8,10-14,16-17H,3,5-6,9,15,18H2,(H,32,35) |
| InChIKey | BPVIOJIDVDLBPM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|