C44H81NO3 — CID 121330750
[(11Z,14Z)-3-[3-(dimethylamino)propyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl] hydrogen carbonate (PubChem CID 121330750) has the molecular formula C44H81NO3 and a molecular weight of 672.14 g/mol. Its IUPAC name is [(11Z,14Z)-3-[3-(dimethylamino)propyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl] hydrogen carbonate.
| Compound Name | [(11Z,14Z)-3-[3-(dimethylamino)propyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl] hydrogen carbonate |
|---|---|
| PubChem CID | 121330750 |
| Molecular Formula | C44H81NO3 |
| Molecular Weight | 672.14 g/mol |
| Exact Mass | 671.62 |
| IUPAC Name | [(11Z,14Z)-3-[3-(dimethylamino)propyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl] hydrogen carbonate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(COC(=O)O)C(CCCCCCC/C=C\C/C=C\CCCCC)CCCN(C)C |
| InChI | InChI=1S/C44H81NO3/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-43(41-48-44(46)47)42(39-36-40-45(3)4)37-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,42-43H,5-12,17-18,23-41H2,1-4H3,(H,46,47)/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | KOPZATQBFFOEOJ-KWXKLSQISA-N |
| XLogP | 14.27 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.14 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|