C34H63NO3 — CID 121330757
[(5Z,21Z,24Z)-1-(dimethylamino)-4-methyltriaconta-5,21,24-trien-13-yl] hydrogen carbonate (PubChem CID 121330757) has the molecular formula C34H63NO3 and a molecular weight of 533.88 g/mol. Its IUPAC name is [(5Z,21Z,24Z)-1-(dimethylamino)-4-methyltriaconta-5,21,24-trien-13-yl] hydrogen carbonate.
| Compound Name | [(5Z,21Z,24Z)-1-(dimethylamino)-4-methyltriaconta-5,21,24-trien-13-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 121330757 |
| Molecular Formula | C34H63NO3 |
| Molecular Weight | 533.88 g/mol |
| Exact Mass | 533.48 |
| IUPAC Name | [(5Z,21Z,24Z)-1-(dimethylamino)-4-methyltriaconta-5,21,24-trien-13-yl] hydrogen carbonate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(CCCCCC/C=C\C(C)CCCN(C)C)OC(=O)O |
| InChI | InChI=1S/C34H63NO3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-21-24-29-33(38-34(36)37)30-25-22-19-18-20-23-27-32(2)28-26-31-35(3)4/h9-10,12-13,23,27,32-33H,5-8,11,14-22,24-26,28-31H2,1-4H3,(H,36,37)/b10-9-,13-12-,27-23- |
| InChIKey | JWPXHDBRLHELSF-VYFJVXOISA-N |
| XLogP | 10.74 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.88 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|