About [1-(azetidin-1-yl)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate
[1-(azetidin-1-yl)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate (PubChem CID 121330770) has the molecular formula C35H65NO3
and a molecular weight of 547.91 g/mol. Its IUPAC name is [1-(azetidin-1-yl)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [1-(azetidin-1-yl)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate |
| PubChem CID | 121330770 |
| Molecular Formula | C35H65NO3 |
| Molecular Weight | 547.91 g/mol |
| Exact Mass | 547.50 |
| IUPAC Name | [1-(azetidin-1-yl)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate |
| SMILES | CCCCCC=CCC=CCCCCCCCC(CCCCCCCCC(C)CCCN1CCC1)OC(=O)O |
| InChI | InChI=1S/C35H65NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-28-34(39-35(37)38)29-23-20-17-16-18-21-26-33(2)27-24-30-36-31-25-32-36/h7-8,10-11,33-34H,3-6,9,12-32H2,1-2H3,(H,37,38) |
| InChIKey | VDTDVXJCKLLRRD-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 547.91 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-(azetidin-1-yl)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(azetidin-1-yl)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate?
The IUPAC name of [1-(azetidin-1-yl)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate (CID 121330770) is [1-(azetidin-1-yl)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate.
What is the SMILES notation for [1-(azetidin-1-yl)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate?
The canonical SMILES for [1-(azetidin-1-yl)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate is CCCCCC=CCC=CCCCCCCCC(CCCCCCCCC(C)CCCN1CCC1)OC(=O)O.
What is the InChIKey of [1-(azetidin-1-yl)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate?
The InChIKey is VDTDVXJCKLLRRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H65NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-28-34(39-35(37)38)29-23-20-17-16-18-21-26-33(2)27-24-30-36-31-25-32-36/h7-8,10-11,33-34H,3-6,9,12-32H2,1-2H3,(H,37,38).
What are the key properties of [1-(azetidin-1-yl)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate?
[1-(azetidin-1-yl)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate has a molecular weight of 547.91 g/mol, XLogP of 11.11, 28 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(azetidin-1-yl)-4-methyltriaconta-21,24-dien-13-yl] hydrogen carbonate is sourced from PubChem (CID 121330770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).