C42H77NO3 — CID 121330782
[(6Z,9Z,26Z,29Z)-38-(dimethylamino)-34-methyloctatriaconta-6,9,26,29-tetraen-18-yl] hydrogen carbonate (PubChem CID 121330782) has the molecular formula C42H77NO3 and a molecular weight of 644.08 g/mol. Its IUPAC name is [(6Z,9Z,26Z,29Z)-38-(dimethylamino)-34-methyloctatriaconta-6,9,26,29-tetraen-18-yl] hydrogen carbonate.
| Compound Name | [(6Z,9Z,26Z,29Z)-38-(dimethylamino)-34-methyloctatriaconta-6,9,26,29-tetraen-18-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 121330782 |
| Molecular Formula | C42H77NO3 |
| Molecular Weight | 644.08 g/mol |
| Exact Mass | 643.59 |
| IUPAC Name | [(6Z,9Z,26Z,29Z)-38-(dimethylamino)-34-methyloctatriaconta-6,9,26,29-tetraen-18-yl] hydrogen carbonate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(CCCCCCC/C=C\C/C=C\CCCC(C)CCCCN(C)C)OC(=O)O |
| InChI | InChI=1S/C42H77NO3/c1-5-6-7-8-9-10-11-12-13-16-19-22-25-28-31-37-41(46-42(44)45)38-32-29-26-23-20-17-14-15-18-21-24-27-30-35-40(2)36-33-34-39-43(3)4/h9-10,12-15,21,24,40-41H,5-8,11,16-20,22-23,25-39H2,1-4H3,(H,44,45)/b10-9-,13-12-,15-14-,24-21- |
| InChIKey | DDDFENCNEFOJSU-KHCGOADHSA-N |
| XLogP | 13.63 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.08 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|