C36H69NO3 — CID 121330893
[(23Z,26Z)-1-(dimethylamino)-4-methyldotriaconta-23,26-dien-13-yl] hydrogen carbonate (PubChem CID 121330893) has the molecular formula C36H69NO3 and a molecular weight of 563.95 g/mol. Its IUPAC name is [(23Z,26Z)-1-(dimethylamino)-4-methyldotriaconta-23,26-dien-13-yl] hydrogen carbonate.
| Compound Name | [(23Z,26Z)-1-(dimethylamino)-4-methyldotriaconta-23,26-dien-13-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 121330893 |
| Molecular Formula | C36H69NO3 |
| Molecular Weight | 563.95 g/mol |
| Exact Mass | 563.53 |
| IUPAC Name | [(23Z,26Z)-1-(dimethylamino)-4-methyldotriaconta-23,26-dien-13-yl] hydrogen carbonate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(CCCCCCCCC(C)CCCN(C)C)OC(=O)O |
| InChI | InChI=1S/C36H69NO3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-26-31-35(40-36(38)39)32-27-24-21-20-22-25-29-34(2)30-28-33-37(3)4/h9-10,12-13,34-35H,5-8,11,14-33H2,1-4H3,(H,38,39)/b10-9-,13-12- |
| InChIKey | DEQIRJGTLWDHOU-UTJQPWESSA-N |
| XLogP | 11.74 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.95 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|