C45H83NO3 — CID 121330991
[(11Z,14Z)-4-[4-(dimethylamino)butyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl] hydrogen carbonate (PubChem CID 121330991) has the molecular formula C45H83NO3 and a molecular weight of 686.16 g/mol. Its IUPAC name is [(11Z,14Z)-4-[4-(dimethylamino)butyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl] hydrogen carbonate.
| Compound Name | [(11Z,14Z)-4-[4-(dimethylamino)butyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl] hydrogen carbonate |
|---|---|
| PubChem CID | 121330991 |
| Molecular Formula | C45H83NO3 |
| Molecular Weight | 686.16 g/mol |
| Exact Mass | 685.64 |
| IUPAC Name | [(11Z,14Z)-4-[4-(dimethylamino)butyl]-2-[(9Z,12Z)-octadeca-9,12-dienyl]icosa-11,14-dienyl] hydrogen carbonate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(COC(=O)O)CC(CCCCCC/C=C\C/C=C\CCCCC)CCCCN(C)C |
| InChI | InChI=1S/C45H83NO3/c1-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-39-44(42-49-45(47)48)41-43(38-35-36-40-46(3)4)37-33-31-29-27-25-23-20-18-16-14-12-10-8-6-2/h13-16,19-21,23,43-44H,5-12,17-18,22,24-42H2,1-4H3,(H,47,48)/b15-13-,16-14-,21-19-,23-20- |
| InChIKey | VWCYZFXGRYWHEA-PNOCIVJDSA-N |
| XLogP | 14.66 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.16 |
| LogP ≤ 5 | 14.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|