C24H28N2O5S2 — CID 121331515
1-N,1-N,3-N,3-N-tetrakis(oxiran-2-ylmethyl)-4-phenylsulfanyloxysulfanylbenzene-1,3-diamine (PubChem CID 121331515) has the molecular formula C24H28N2O5S2 and a molecular weight of 488.63 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N-tetrakis(oxiran-2-ylmethyl)-4-phenylsulfanyloxysulfanylbenzene-1,3-diamine.
| Compound Name | 1-N,1-N,3-N,3-N-tetrakis(oxiran-2-ylmethyl)-4-phenylsulfanyloxysulfanylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 121331515 |
| Molecular Formula | C24H28N2O5S2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 1-N,1-N,3-N,3-N-tetrakis(oxiran-2-ylmethyl)-4-phenylsulfanyloxysulfanylbenzene-1,3-diamine |
| SMILES | c1ccc(SOSc2ccc(N(CC3CO3)CC3CO3)cc2N(CC2CO2)CC2CO2)cc1 |
| InChI | InChI=1S/C24H28N2O5S2/c1-2-4-22(5-3-1)32-31-33-24-7-6-17(25(9-18-13-27-18)10-19-14-28-19)8-23(24)26(11-20-15-29-20)12-21-16-30-21/h1-8,18-21H,9-16H2 |
| InChIKey | KQEQDKBYHNVGPG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|