About 2-(1-methoxyethoxy)-1,3,2λ5-dioxaphospholane 2-oxide
2-(1-methoxyethoxy)-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 121331652) has the molecular formula C5H11O5P
and a molecular weight of 182.11 g/mol. Its IUPAC name is 2-(1-methoxyethoxy)-1,3,2λ5-dioxaphospholane 2-oxide.
Molecular Properties
| Compound Name | 2-(1-methoxyethoxy)-1,3,2λ5-dioxaphospholane 2-oxide |
| PubChem CID | 121331652 |
| Molecular Formula | C5H11O5P |
| Molecular Weight | 182.11 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 2-(1-methoxyethoxy)-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | COC(C)OP1(=O)OCCO1 |
| InChI | InChI=1S/C5H11O5P/c1-5(7-2)10-11(6)8-3-4-9-11/h5H,3-4H2,1-2H3 |
| InChIKey | JGBUXQDTKLDTOI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.11 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-methoxyethoxy)-1,3,2λ5-dioxaphospholane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methoxyethoxy)-1,3,2λ5-dioxaphospholane 2-oxide?
The IUPAC name of 2-(1-methoxyethoxy)-1,3,2λ5-dioxaphospholane 2-oxide (CID 121331652) is 2-(1-methoxyethoxy)-1,3,2λ5-dioxaphospholane 2-oxide.
What is the SMILES notation for 2-(1-methoxyethoxy)-1,3,2λ5-dioxaphospholane 2-oxide?
The canonical SMILES for 2-(1-methoxyethoxy)-1,3,2λ5-dioxaphospholane 2-oxide is COC(C)OP1(=O)OCCO1.
What is the InChIKey of 2-(1-methoxyethoxy)-1,3,2λ5-dioxaphospholane 2-oxide?
The InChIKey is JGBUXQDTKLDTOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11O5P/c1-5(7-2)10-11(6)8-3-4-9-11/h5H,3-4H2,1-2H3.
What are the key properties of 2-(1-methoxyethoxy)-1,3,2λ5-dioxaphospholane 2-oxide?
2-(1-methoxyethoxy)-1,3,2λ5-dioxaphospholane 2-oxide has a molecular weight of 182.11 g/mol, XLogP of 1.15, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methoxyethoxy)-1,3,2λ5-dioxaphospholane 2-oxide is sourced from PubChem (CID 121331652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).