About S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-phenylpentanethioate
S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-phenylpentanethioate (PubChem CID 121331700) has the molecular formula C17H16F2O2S
and a molecular weight of 322.38 g/mol. Its IUPAC name is S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-phenylpentanethioate.
Molecular Properties
| Compound Name | S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-phenylpentanethioate |
| PubChem CID | 121331700 |
| Molecular Formula | C17H16F2O2S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-phenylpentanethioate |
| SMILES | O=C(Sc1ccccc1F)[C@@H](F)[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C17H16F2O2S/c18-13-8-4-5-9-15(13)22-17(21)16(19)14(20)11-10-12-6-2-1-3-7-12/h1-9,14,16,20H,10-11H2/t14-,16-/m0/s1 |
| InChIKey | ZKWCMCLWUONMCO-HOCLYGCPSA-N |
| XLogP | 3.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-phenylpentanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-phenylpentanethioate?
The IUPAC name of S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-phenylpentanethioate (CID 121331700) is S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-phenylpentanethioate.
What is the SMILES notation for S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-phenylpentanethioate?
The canonical SMILES for S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-phenylpentanethioate is O=C(Sc1ccccc1F)[C@@H](F)[C@@H](O)CCc1ccccc1.
What is the InChIKey of S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-phenylpentanethioate?
The InChIKey is ZKWCMCLWUONMCO-HOCLYGCPSA-N. The full InChI is InChI=1S/C17H16F2O2S/c18-13-8-4-5-9-15(13)22-17(21)16(19)14(20)11-10-12-6-2-1-3-7-12/h1-9,14,16,20H,10-11H2/t14-,16-/m0/s1.
What are the key properties of S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-phenylpentanethioate?
S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-phenylpentanethioate has a molecular weight of 322.38 g/mol, XLogP of 3.78, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-phenylpentanethioate is sourced from PubChem (CID 121331700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).