About 4-[2,6-bis(3-methylmorpholin-4-yl)-7H-purin-8-yl]-1H-indole-6-carboxylic acid
4-[2,6-bis(3-methylmorpholin-4-yl)-7H-purin-8-yl]-1H-indole-6-carboxylic acid (PubChem CID 121331899) has the molecular formula C24H27N7O4
and a molecular weight of 477.53 g/mol. Its IUPAC name is 4-[2,6-bis(3-methylmorpholin-4-yl)-7H-purin-8-yl]-1H-indole-6-carboxylic acid.
Molecular Properties
| Compound Name | 4-[2,6-bis(3-methylmorpholin-4-yl)-7H-purin-8-yl]-1H-indole-6-carboxylic acid |
| PubChem CID | 121331899 |
| Molecular Formula | C24H27N7O4 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 4-[2,6-bis(3-methylmorpholin-4-yl)-7H-purin-8-yl]-1H-indole-6-carboxylic acid |
| SMILES | CC1COCCN1c1nc(N2CCOCC2C)c2[nH]c(-c3cc(C(=O)O)cc4[nH]ccc34)nc2n1 |
| InChI | InChI=1S/C24H27N7O4/c1-13-11-34-7-5-30(13)22-19-21(28-24(29-22)31-6-8-35-12-14(31)2)27-20(26-19)17-9-15(23(32)33)10-18-16(17)3-4-25-18/h3-4,9-10,13-14,25H,5-8,11-12H2,1-2H3,(H,32,33)(H,26,27,28,29) |
| InChIKey | IMUKWHKNZCANRB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 132.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[2,6-bis(3-methylmorpholin-4-yl)-7H-purin-8-yl]-1H-indole-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,6-bis(3-methylmorpholin-4-yl)-7H-purin-8-yl]-1H-indole-6-carboxylic acid?
The IUPAC name of 4-[2,6-bis(3-methylmorpholin-4-yl)-7H-purin-8-yl]-1H-indole-6-carboxylic acid (CID 121331899) is 4-[2,6-bis(3-methylmorpholin-4-yl)-7H-purin-8-yl]-1H-indole-6-carboxylic acid.
What is the SMILES notation for 4-[2,6-bis(3-methylmorpholin-4-yl)-7H-purin-8-yl]-1H-indole-6-carboxylic acid?
The canonical SMILES for 4-[2,6-bis(3-methylmorpholin-4-yl)-7H-purin-8-yl]-1H-indole-6-carboxylic acid is CC1COCCN1c1nc(N2CCOCC2C)c2[nH]c(-c3cc(C(=O)O)cc4[nH]ccc34)nc2n1.
What is the InChIKey of 4-[2,6-bis(3-methylmorpholin-4-yl)-7H-purin-8-yl]-1H-indole-6-carboxylic acid?
The InChIKey is IMUKWHKNZCANRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N7O4/c1-13-11-34-7-5-30(13)22-19-21(28-24(29-22)31-6-8-35-12-14(31)2)27-20(26-19)17-9-15(23(32)33)10-18-16(17)3-4-25-18/h3-4,9-10,13-14,25H,5-8,11-12H2,1-2H3,(H,32,33)(H,26,27,28,29).
What are the key properties of 4-[2,6-bis(3-methylmorpholin-4-yl)-7H-purin-8-yl]-1H-indole-6-carboxylic acid?
4-[2,6-bis(3-methylmorpholin-4-yl)-7H-purin-8-yl]-1H-indole-6-carboxylic acid has a molecular weight of 477.53 g/mol, XLogP of 2.65, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,6-bis(3-methylmorpholin-4-yl)-7H-purin-8-yl]-1H-indole-6-carboxylic acid is sourced from PubChem (CID 121331899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).