2,2-dimethylpropane-1,3-diol;3-oxobutanoic acid

C9H18O5 — CID 121332471

IUPAC2,2-dimethylpropane-1,3-diol;3-oxobutanoic acid
SMILESCC(=O)CC(=O)O.CC(C)(CO)CO
InChIInChI=1S/C5H12O2.C4H6O3/c1-5(2,3-6)4-7;1-3(5)2-4(6)7/h6-7H,3-4H2,1-2H3;2H2,1H3,(H,6,7)
InChIKeyVOTNPIOAXLYRDK-UHFFFAOYSA-N
MW206.24 g/mol
LogP0.05
Rot. Bonds4

About 2,2-dimethylpropane-1,3-diol;3-oxobutanoic acid

2,2-dimethylpropane-1,3-diol;3-oxobutanoic acid (PubChem CID 121332471) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2,2-dimethylpropane-1,3-diol;3-oxobutanoic acid.

Molecular Properties

Compound Name2,2-dimethylpropane-1,3-diol;3-oxobutanoic acid
PubChem CID121332471
Molecular FormulaC9H18O5
Molecular Weight206.24 g/mol
Exact Mass206.12
IUPAC Name2,2-dimethylpropane-1,3-diol;3-oxobutanoic acid
SMILESCC(=O)CC(=O)O.CC(C)(CO)CO
InChIInChI=1S/C5H12O2.C4H6O3/c1-5(2,3-6)4-7;1-3(5)2-4(6)7/h6-7H,3-4H2,1-2H3;2H2,1H3,(H,6,7)
InChIKeyVOTNPIOAXLYRDK-UHFFFAOYSA-N
XLogP0.05
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.24
LogP ≤ 50.05
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2,2-dimethylpropane-1,3-diol;3-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethylpropane-1,3-diol;3-oxobutanoic acid?
The IUPAC name of 2,2-dimethylpropane-1,3-diol;3-oxobutanoic acid (CID 121332471) is 2,2-dimethylpropane-1,3-diol;3-oxobutanoic acid.
What is the SMILES notation for 2,2-dimethylpropane-1,3-diol;3-oxobutanoic acid?
The canonical SMILES for 2,2-dimethylpropane-1,3-diol;3-oxobutanoic acid is CC(=O)CC(=O)O.CC(C)(CO)CO.
What is the InChIKey of 2,2-dimethylpropane-1,3-diol;3-oxobutanoic acid?
The InChIKey is VOTNPIOAXLYRDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2.C4H6O3/c1-5(2,3-6)4-7;1-3(5)2-4(6)7/h6-7H,3-4H2,1-2H3;2H2,1H3,(H,6,7).
What are the key properties of 2,2-dimethylpropane-1,3-diol;3-oxobutanoic acid?
2,2-dimethylpropane-1,3-diol;3-oxobutanoic acid has a molecular weight of 206.24 g/mol, XLogP of 0.05, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropane-1,3-diol;3-oxobutanoic acid is sourced from PubChem (CID 121332471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).