C31H30N2O4 — CID 121332700
3-[4-(2-tert-butylphenoxy)-3-[(3-methylphenyl)carbamoylamino]phenyl]benzoic acid (PubChem CID 121332700) has the molecular formula C31H30N2O4 and a molecular weight of 494.59 g/mol. Its IUPAC name is 3-[4-(2-tert-butylphenoxy)-3-[(3-methylphenyl)carbamoylamino]phenyl]benzoic acid.
| Compound Name | 3-[4-(2-tert-butylphenoxy)-3-[(3-methylphenyl)carbamoylamino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 121332700 |
| Molecular Formula | C31H30N2O4 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 3-[4-(2-tert-butylphenoxy)-3-[(3-methylphenyl)carbamoylamino]phenyl]benzoic acid |
| SMILES | Cc1cccc(NC(=O)Nc2cc(-c3cccc(C(=O)O)c3)ccc2Oc2ccccc2C(C)(C)C)c1 |
| InChI | InChI=1S/C31H30N2O4/c1-20-9-7-12-24(17-20)32-30(36)33-26-19-22(21-10-8-11-23(18-21)29(34)35)15-16-28(26)37-27-14-6-5-13-25(27)31(2,3)4/h5-19H,1-4H3,(H,34,35)(H2,32,33,36) |
| InChIKey | XKRKCLXACCAXIS-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |