About 2,2-dimethyl-N-(4-methylphenyl)-1,3-benzodioxol-4-amine
2,2-dimethyl-N-(4-methylphenyl)-1,3-benzodioxol-4-amine (PubChem CID 121332944) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is 2,2-dimethyl-N-(4-methylphenyl)-1,3-benzodioxol-4-amine.
Molecular Properties
| Compound Name | 2,2-dimethyl-N-(4-methylphenyl)-1,3-benzodioxol-4-amine |
| PubChem CID | 121332944 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2,2-dimethyl-N-(4-methylphenyl)-1,3-benzodioxol-4-amine |
| SMILES | Cc1ccc(Nc2cccc3c2OC(C)(C)O3)cc1 |
| InChI | InChI=1S/C16H17NO2/c1-11-7-9-12(10-8-11)17-13-5-4-6-14-15(13)19-16(2,3)18-14/h4-10,17H,1-3H3 |
| InChIKey | ISJUKNHLDBGVQK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-N-(4-methylphenyl)-1,3-benzodioxol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-N-(4-methylphenyl)-1,3-benzodioxol-4-amine?
The IUPAC name of 2,2-dimethyl-N-(4-methylphenyl)-1,3-benzodioxol-4-amine (CID 121332944) is 2,2-dimethyl-N-(4-methylphenyl)-1,3-benzodioxol-4-amine.
What is the SMILES notation for 2,2-dimethyl-N-(4-methylphenyl)-1,3-benzodioxol-4-amine?
The canonical SMILES for 2,2-dimethyl-N-(4-methylphenyl)-1,3-benzodioxol-4-amine is Cc1ccc(Nc2cccc3c2OC(C)(C)O3)cc1.
What is the InChIKey of 2,2-dimethyl-N-(4-methylphenyl)-1,3-benzodioxol-4-amine?
The InChIKey is ISJUKNHLDBGVQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2/c1-11-7-9-12(10-8-11)17-13-5-4-6-14-15(13)19-16(2,3)18-14/h4-10,17H,1-3H3.
What are the key properties of 2,2-dimethyl-N-(4-methylphenyl)-1,3-benzodioxol-4-amine?
2,2-dimethyl-N-(4-methylphenyl)-1,3-benzodioxol-4-amine has a molecular weight of 255.32 g/mol, XLogP of 4.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-N-(4-methylphenyl)-1,3-benzodioxol-4-amine is sourced from PubChem (CID 121332944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).