About (2S)-2-phenyl-1,3-oxazolidin-4-one
(2S)-2-phenyl-1,3-oxazolidin-4-one (PubChem CID 121333258) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is (2S)-2-phenyl-1,3-oxazolidin-4-one.
Molecular Properties
| Compound Name | (2S)-2-phenyl-1,3-oxazolidin-4-one |
| PubChem CID | 121333258 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | (2S)-2-phenyl-1,3-oxazolidin-4-one |
| SMILES | O=C1CO[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C9H9NO2/c11-8-6-12-9(10-8)7-4-2-1-3-5-7/h1-5,9H,6H2,(H,10,11)/t9-/m0/s1 |
| InChIKey | RVFRYUNGRFJAFI-VIFPVBQESA-N |
| XLogP | 0.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-phenyl-1,3-oxazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-phenyl-1,3-oxazolidin-4-one?
The IUPAC name of (2S)-2-phenyl-1,3-oxazolidin-4-one (CID 121333258) is (2S)-2-phenyl-1,3-oxazolidin-4-one.
What is the SMILES notation for (2S)-2-phenyl-1,3-oxazolidin-4-one?
The canonical SMILES for (2S)-2-phenyl-1,3-oxazolidin-4-one is O=C1CO[C@@H](c2ccccc2)N1.
What is the InChIKey of (2S)-2-phenyl-1,3-oxazolidin-4-one?
The InChIKey is RVFRYUNGRFJAFI-VIFPVBQESA-N. The full InChI is InChI=1S/C9H9NO2/c11-8-6-12-9(10-8)7-4-2-1-3-5-7/h1-5,9H,6H2,(H,10,11)/t9-/m0/s1.
What are the key properties of (2S)-2-phenyl-1,3-oxazolidin-4-one?
(2S)-2-phenyl-1,3-oxazolidin-4-one has a molecular weight of 163.18 g/mol, XLogP of 0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-phenyl-1,3-oxazolidin-4-one is sourced from PubChem (CID 121333258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).