About 4-fluoro-2-[[(1S,5R)-8-(2-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde
4-fluoro-2-[[(1S,5R)-8-(2-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde (PubChem CID 121333337) has the molecular formula C16H20FNO3
and a molecular weight of 293.34 g/mol. Its IUPAC name is 4-fluoro-2-[[(1S,5R)-8-(2-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde.
Molecular Properties
| Compound Name | 4-fluoro-2-[[(1S,5R)-8-(2-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde |
| PubChem CID | 121333337 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-fluoro-2-[[(1S,5R)-8-(2-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde |
| SMILES | O=Cc1ccc(F)cc1OC1C[C@H]2CC[C@@H](C1)N2CCO |
| InChI | InChI=1S/C16H20FNO3/c17-12-2-1-11(10-20)16(7-12)21-15-8-13-3-4-14(9-15)18(13)5-6-19/h1-2,7,10,13-15,19H,3-6,8-9H2/t13-,14+,15? |
| InChIKey | QKMJIVHSBQKPJL-YIONKMFJSA-N |
| XLogP | 2.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-2-[[(1S,5R)-8-(2-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2-[[(1S,5R)-8-(2-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde?
The IUPAC name of 4-fluoro-2-[[(1S,5R)-8-(2-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde (CID 121333337) is 4-fluoro-2-[[(1S,5R)-8-(2-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde.
What is the SMILES notation for 4-fluoro-2-[[(1S,5R)-8-(2-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde?
The canonical SMILES for 4-fluoro-2-[[(1S,5R)-8-(2-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde is O=Cc1ccc(F)cc1OC1C[C@H]2CC[C@@H](C1)N2CCO.
What is the InChIKey of 4-fluoro-2-[[(1S,5R)-8-(2-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde?
The InChIKey is QKMJIVHSBQKPJL-YIONKMFJSA-N. The full InChI is InChI=1S/C16H20FNO3/c17-12-2-1-11(10-20)16(7-12)21-15-8-13-3-4-14(9-15)18(13)5-6-19/h1-2,7,10,13-15,19H,3-6,8-9H2/t13-,14+,15?.
What are the key properties of 4-fluoro-2-[[(1S,5R)-8-(2-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde?
4-fluoro-2-[[(1S,5R)-8-(2-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde has a molecular weight of 293.34 g/mol, XLogP of 2.00, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-[[(1S,5R)-8-(2-hydroxyethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzaldehyde is sourced from PubChem (CID 121333337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).