C28H5F13 — CID 121333824
1,2,3,4,5,6,7,8,9,10,11,13,14-tridecafluoro-12-phenylpentaphene (PubChem CID 121333824) has the molecular formula C28H5F13 and a molecular weight of 588.32 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,9,10,11,13,14-tridecafluoro-12-phenylpentaphene.
| Compound Name | 1,2,3,4,5,6,7,8,9,10,11,13,14-tridecafluoro-12-phenylpentaphene |
|---|---|
| PubChem CID | 121333824 |
| Molecular Formula | C28H5F13 |
| Molecular Weight | 588.32 g/mol |
| Exact Mass | 588.02 |
| IUPAC Name | 1,2,3,4,5,6,7,8,9,10,11,13,14-tridecafluoro-12-phenylpentaphene |
| SMILES | Fc1c(F)c(F)c2c(F)c3c(c(F)c(F)c4c(F)c5c(F)c(F)c(F)c(-c6ccccc6)c5c(F)c43)c(F)c2c1F |
| InChI | InChI=1S/C28H5F13/c29-16-8-7(6-4-2-1-3-5-6)20(33)26(39)23(36)11(8)18(31)12-9(16)10-13(22(35)21(12)34)19(32)15-14(17(10)30)24(37)27(40)28(41)25(15)38/h1-5H |
| InChIKey | NFPCKDNMDMIMPX-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.32 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|