C21H29F2N7O2 — CID 121334376
4-(difluoromethyl)-5-[4-(3,3-dimethylmorpholin-4-yl)-6-[(3R,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]pyridin-2-amine (PubChem CID 121334376) has the molecular formula C21H29F2N7O2 and a molecular weight of 449.51 g/mol. Its IUPAC name is 4-(difluoromethyl)-5-[4-(3,3-dimethylmorpholin-4-yl)-6-[(3R,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]pyridin-2-amine.
| Compound Name | 4-(difluoromethyl)-5-[4-(3,3-dimethylmorpholin-4-yl)-6-[(3R,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 121334376 |
| Molecular Formula | C21H29F2N7O2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 4-(difluoromethyl)-5-[4-(3,3-dimethylmorpholin-4-yl)-6-[(3R,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]pyridin-2-amine |
| SMILES | C[C@@H]1COC[C@H](C)N1c1nc(-c2cnc(N)cc2C(F)F)nc(N2CCOCC2(C)C)n1 |
| InChI | InChI=1S/C21H29F2N7O2/c1-12-9-32-10-13(2)30(12)20-27-18(15-8-25-16(24)7-14(15)17(22)23)26-19(28-20)29-5-6-31-11-21(29,3)4/h7-8,12-13,17H,5-6,9-11H2,1-4H3,(H2,24,25)/t12-,13+ |
| InChIKey | BTEITQGUDSFYAG-BETUJISGSA-N |
| XLogP | 2.68 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |