C21H28F2N6O2 — CID 121334413
(3S,5R)-4-[4-[4-(difluoromethyl)-3-pyridinyl]-6-[(3R,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]-3,5-dimethylmorpholine (PubChem CID 121334413) has the molecular formula C21H28F2N6O2 and a molecular weight of 434.49 g/mol. Its IUPAC name is (3S,5R)-4-[4-[4-(difluoromethyl)-3-pyridinyl]-6-[(3R,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]-3,5-dimethylmorpholine.
| Compound Name | (3S,5R)-4-[4-[4-(difluoromethyl)-3-pyridinyl]-6-[(3R,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]-3,5-dimethylmorpholine |
|---|---|
| PubChem CID | 121334413 |
| Molecular Formula | C21H28F2N6O2 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (3S,5R)-4-[4-[4-(difluoromethyl)-3-pyridinyl]-6-[(3R,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]-3,5-dimethylmorpholine |
| SMILES | C[C@@H]1COC[C@H](C)N1c1nc(-c2cnccc2C(F)F)nc(N2[C@H](C)COC[C@@H]2C)n1 |
| InChI | InChI=1S/C21H28F2N6O2/c1-12-8-30-9-13(2)28(12)20-25-19(17-7-24-6-5-16(17)18(22)23)26-21(27-20)29-14(3)10-31-11-15(29)4/h5-7,12-15,18H,8-11H2,1-4H3/t12-,13+,14-,15+ |
| InChIKey | YWZFEUWTODSMMZ-NMWPEEMBSA-N |
| XLogP | 3.10 |
| TPSA | 76.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |