C14H16BrFN2O4 — CID 121334485
(2R,4R)-4-[(6-bromo-3-fluoro-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylic acid (PubChem CID 121334485) has the molecular formula C14H16BrFN2O4 and a molecular weight of 375.19 g/mol. Its IUPAC name is (2R,4R)-4-[(6-bromo-3-fluoro-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylic acid.
| Compound Name | (2R,4R)-4-[(6-bromo-3-fluoro-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 121334485 |
| Molecular Formula | C14H16BrFN2O4 |
| Molecular Weight | 375.19 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | (2R,4R)-4-[(6-bromo-3-fluoro-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylic acid |
| SMILES | C[C@@H]1C[C@](Cc2nc(Br)ccc2F)(C(=O)O)CCN1C(=O)O |
| InChI | InChI=1S/C14H16BrFN2O4/c1-8-6-14(12(19)20,4-5-18(8)13(21)22)7-10-9(16)2-3-11(15)17-10/h2-3,8H,4-7H2,1H3,(H,19,20)(H,21,22)/t8-,14-/m1/s1 |
| InChIKey | YFWSOSASBHBGDS-XLKFXECMSA-N |
| XLogP | 2.76 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.19 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|