About 6-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrrolo[2,3-c]pyridin-7-one
6-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 121334626) has the molecular formula C16H13N3O2
and a molecular weight of 279.30 g/mol. Its IUPAC name is 6-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrrolo[2,3-c]pyridin-7-one.
Molecular Properties
| Compound Name | 6-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrrolo[2,3-c]pyridin-7-one |
| PubChem CID | 121334626 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 6-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | Cn1cc(-c2ccc3c(c2)CC(=O)N3)c2cc[nH]c2c1=O |
| InChI | InChI=1S/C16H13N3O2/c1-19-8-12(11-4-5-17-15(11)16(19)21)9-2-3-13-10(6-9)7-14(20)18-13/h2-6,8,17H,7H2,1H3,(H,18,20) |
| InChIKey | VYADDULJPIGBFN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrrolo[2,3-c]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrrolo[2,3-c]pyridin-7-one?
The IUPAC name of 6-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrrolo[2,3-c]pyridin-7-one (CID 121334626) is 6-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrrolo[2,3-c]pyridin-7-one.
What is the SMILES notation for 6-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrrolo[2,3-c]pyridin-7-one?
The canonical SMILES for 6-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrrolo[2,3-c]pyridin-7-one is Cn1cc(-c2ccc3c(c2)CC(=O)N3)c2cc[nH]c2c1=O.
What is the InChIKey of 6-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrrolo[2,3-c]pyridin-7-one?
The InChIKey is VYADDULJPIGBFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O2/c1-19-8-12(11-4-5-17-15(11)16(19)21)9-2-3-13-10(6-9)7-14(20)18-13/h2-6,8,17H,7H2,1H3,(H,18,20).
What are the key properties of 6-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrrolo[2,3-c]pyridin-7-one?
6-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrrolo[2,3-c]pyridin-7-one has a molecular weight of 279.30 g/mol, XLogP of 2.03, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4-(2-oxo-1,3-dihydroindol-5-yl)-1H-pyrrolo[2,3-c]pyridin-7-one is sourced from PubChem (CID 121334626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).