About 2-(1,8-diamino-2-adamantyl)-N-methylbenzenesulfonamide
2-(1,8-diamino-2-adamantyl)-N-methylbenzenesulfonamide (PubChem CID 121334901) has the molecular formula C17H25N3O2S
and a molecular weight of 335.47 g/mol. Its IUPAC name is 2-(1,8-diamino-2-adamantyl)-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-(1,8-diamino-2-adamantyl)-N-methylbenzenesulfonamide |
| PubChem CID | 121334901 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-(1,8-diamino-2-adamantyl)-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccccc1C1C2CC3CC(C2)C(N)C1(N)C3 |
| InChI | InChI=1S/C17H25N3O2S/c1-20-23(21,22)14-5-3-2-4-13(14)15-11-6-10-7-12(8-11)16(18)17(15,19)9-10/h2-5,10-12,15-16,20H,6-9,18-19H2,1H3 |
| InChIKey | FAGHEYXDCPFZKK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,8-diamino-2-adamantyl)-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,8-diamino-2-adamantyl)-N-methylbenzenesulfonamide?
The IUPAC name of 2-(1,8-diamino-2-adamantyl)-N-methylbenzenesulfonamide (CID 121334901) is 2-(1,8-diamino-2-adamantyl)-N-methylbenzenesulfonamide.
What is the SMILES notation for 2-(1,8-diamino-2-adamantyl)-N-methylbenzenesulfonamide?
The canonical SMILES for 2-(1,8-diamino-2-adamantyl)-N-methylbenzenesulfonamide is CNS(=O)(=O)c1ccccc1C1C2CC3CC(C2)C(N)C1(N)C3.
What is the InChIKey of 2-(1,8-diamino-2-adamantyl)-N-methylbenzenesulfonamide?
The InChIKey is FAGHEYXDCPFZKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3O2S/c1-20-23(21,22)14-5-3-2-4-13(14)15-11-6-10-7-12(8-11)16(18)17(15,19)9-10/h2-5,10-12,15-16,20H,6-9,18-19H2,1H3.
What are the key properties of 2-(1,8-diamino-2-adamantyl)-N-methylbenzenesulfonamide?
2-(1,8-diamino-2-adamantyl)-N-methylbenzenesulfonamide has a molecular weight of 335.47 g/mol, XLogP of 1.15, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,8-diamino-2-adamantyl)-N-methylbenzenesulfonamide is sourced from PubChem (CID 121334901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).