About N-(difluoromethyl)-1,3-oxazole-4-carboxamide
N-(difluoromethyl)-1,3-oxazole-4-carboxamide (PubChem CID 121334969) has the molecular formula C5H4F2N2O2
and a molecular weight of 162.10 g/mol. Its IUPAC name is N-(difluoromethyl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(difluoromethyl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 121334969 |
| Molecular Formula | C5H4F2N2O2 |
| Molecular Weight | 162.10 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | N-(difluoromethyl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NC(F)F)c1cocn1 |
| InChI | InChI=1S/C5H4F2N2O2/c6-5(7)9-4(10)3-1-11-2-8-3/h1-2,5H,(H,9,10) |
| InChIKey | HBWFWRJFTRXCCC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.10 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(difluoromethyl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(difluoromethyl)-1,3-oxazole-4-carboxamide?
The IUPAC name of N-(difluoromethyl)-1,3-oxazole-4-carboxamide (CID 121334969) is N-(difluoromethyl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-(difluoromethyl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-(difluoromethyl)-1,3-oxazole-4-carboxamide is O=C(NC(F)F)c1cocn1.
What is the InChIKey of N-(difluoromethyl)-1,3-oxazole-4-carboxamide?
The InChIKey is HBWFWRJFTRXCCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F2N2O2/c6-5(7)9-4(10)3-1-11-2-8-3/h1-2,5H,(H,9,10).
What are the key properties of N-(difluoromethyl)-1,3-oxazole-4-carboxamide?
N-(difluoromethyl)-1,3-oxazole-4-carboxamide has a molecular weight of 162.10 g/mol, XLogP of 0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(difluoromethyl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 121334969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).