C32H34NO2+ — CID 121336025
2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-4,6-bis[(1E,3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]benzene-1,3-diol (PubChem CID 121336025) has the molecular formula C32H34NO2+ and a molecular weight of 464.63 g/mol. Its IUPAC name is 2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-4,6-bis[(1E,3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]benzene-1,3-diol.
| Compound Name | 2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-4,6-bis[(1E,3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 121336025 |
| Molecular Formula | C32H34NO2+ |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 2-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]-4,6-bis[(1E,3E)-3-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]benzene-1,3-diol |
| SMILES | C=C/C=C(\C=C/C)/C=C/c1cc(/C=C/C(/C=C\C)=C/C=C)c(O)c(/C=C/c2cc[n+](C)cc2)c1O |
| InChI | InChI=1S/C32H33NO2/c1-6-10-25(11-7-2)14-17-28-24-29(18-15-26(12-8-3)13-9-4)32(35)30(31(28)34)19-16-27-20-22-33(5)23-21-27/h6-24H,1,3H2,2,4-5H3,(H,34,35)/p+1/b11-7-,13-9-,17-14+,18-15+,25-10+,26-12+ |
| InChIKey | DXDBGVPXPMKBJA-BONRJGCISA-O |
| XLogP | 7.50 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|