C6H8F6O3 — CID 121336057
3-(1,1-difluoro-2-hydroxyethoxy)-1,1,2,2-tetrafluorobutan-1-ol (PubChem CID 121336057) has the molecular formula C6H8F6O3 and a molecular weight of 242.12 g/mol. Its IUPAC name is 3-(1,1-difluoro-2-hydroxyethoxy)-1,1,2,2-tetrafluorobutan-1-ol.
| Compound Name | 3-(1,1-difluoro-2-hydroxyethoxy)-1,1,2,2-tetrafluorobutan-1-ol |
|---|---|
| PubChem CID | 121336057 |
| Molecular Formula | C6H8F6O3 |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 3-(1,1-difluoro-2-hydroxyethoxy)-1,1,2,2-tetrafluorobutan-1-ol |
| SMILES | CC(OC(F)(F)CO)C(F)(F)C(O)(F)F |
| InChI | InChI=1S/C6H8F6O3/c1-3(15-4(7,8)2-13)5(9,10)6(11,12)14/h3,13-14H,2H2,1H3 |
| InChIKey | OZVBIURUEBEUQV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|