C10H19FN2 — CID 121336104
(2E,4Z)-3-fluoro-N-methylnona-2,4-diene-1,9-diamine (PubChem CID 121336104) has the molecular formula C10H19FN2 and a molecular weight of 186.27 g/mol. Its IUPAC name is (2E,4Z)-3-fluoro-N-methylnona-2,4-diene-1,9-diamine.
| Compound Name | (2E,4Z)-3-fluoro-N-methylnona-2,4-diene-1,9-diamine |
|---|---|
| PubChem CID | 121336104 |
| Molecular Formula | C10H19FN2 |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | (2E,4Z)-3-fluoro-N-methylnona-2,4-diene-1,9-diamine |
| SMILES | CNC/C=C(F)\C=C/CCCCN |
| InChI | InChI=1S/C10H19FN2/c1-13-9-7-10(11)6-4-2-3-5-8-12/h4,6-7,13H,2-3,5,8-9,12H2,1H3/b6-4-,10-7+ |
| InChIKey | JCIYATFCTXQPQN-BSAFSDHNSA-N |
| XLogP | 1.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|