C11H5Cl3F2N6 — CID 121336284
2-(azidomethyl)-4-(2,4-difluorophenyl)-6-(trichloromethyl)-1,3,5-triazine (PubChem CID 121336284) has the molecular formula C11H5Cl3F2N6 and a molecular weight of 365.56 g/mol. Its IUPAC name is 2-(azidomethyl)-4-(2,4-difluorophenyl)-6-(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-(azidomethyl)-4-(2,4-difluorophenyl)-6-(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 121336284 |
| Molecular Formula | C11H5Cl3F2N6 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | 2-(azidomethyl)-4-(2,4-difluorophenyl)-6-(trichloromethyl)-1,3,5-triazine |
| SMILES | [N-]=[N+]=NCc1nc(-c2ccc(F)cc2F)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C11H5Cl3F2N6/c12-11(13,14)10-20-8(4-18-22-17)19-9(21-10)6-2-1-5(15)3-7(6)16/h1-3H,4H2 |
| InChIKey | ICHWTVGDOLGNRP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 87.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|