About cis-(2R,3S)-2,3-diethylcyclopropan-1-amine
cis-(2R,3S)-2,3-diethylcyclopropan-1-amine (PubChem CID 121336325) has the molecular formula C7H15N
and a molecular weight of 113.20 g/mol. Its IUPAC name is cis-(2R,3S)-2,3-diethylcyclopropan-1-amine.
Molecular Properties
| Compound Name | cis-(2R,3S)-2,3-diethylcyclopropan-1-amine |
| PubChem CID | 121336325 |
| Molecular Formula | C7H15N |
| Molecular Weight | 113.20 g/mol |
| Exact Mass | 113.12 |
| IUPAC Name | cis-(2R,3S)-2,3-diethylcyclopropan-1-amine |
| SMILES | CC[C@@H]1C(N)[C@@H]1CC |
| InChI | InChI=1S/C7H15N/c1-3-5-6(4-2)7(5)8/h5-7H,3-4,8H2,1-2H3/t5-,6+,7? |
| InChIKey | FXSWNVGIBCUQEJ-MEKDEQNOSA-N |
| XLogP | 1.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cis-(2R,3S)-2,3-diethylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2R,3S)-2,3-diethylcyclopropan-1-amine?
The IUPAC name of cis-(2R,3S)-2,3-diethylcyclopropan-1-amine (CID 121336325) is cis-(2R,3S)-2,3-diethylcyclopropan-1-amine.
What is the SMILES notation for cis-(2R,3S)-2,3-diethylcyclopropan-1-amine?
The canonical SMILES for cis-(2R,3S)-2,3-diethylcyclopropan-1-amine is CC[C@@H]1C(N)[C@@H]1CC.
What is the InChIKey of cis-(2R,3S)-2,3-diethylcyclopropan-1-amine?
The InChIKey is FXSWNVGIBCUQEJ-MEKDEQNOSA-N. The full InChI is InChI=1S/C7H15N/c1-3-5-6(4-2)7(5)8/h5-7H,3-4,8H2,1-2H3/t5-,6+,7?.
What are the key properties of cis-(2R,3S)-2,3-diethylcyclopropan-1-amine?
cis-(2R,3S)-2,3-diethylcyclopropan-1-amine has a molecular weight of 113.20 g/mol, XLogP of 1.38, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2R,3S)-2,3-diethylcyclopropan-1-amine is sourced from PubChem (CID 121336325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).