C24H30S2 — CID 121337398
[2,3,4,6,7,8,9,10-octamethyl-5-(sulfanylmethyl)anthracen-1-yl]methanethiol (PubChem CID 121337398) has the molecular formula C24H30S2 and a molecular weight of 382.64 g/mol. Its IUPAC name is [2,3,4,6,7,8,9,10-octamethyl-5-(sulfanylmethyl)anthracen-1-yl]methanethiol.
| Compound Name | [2,3,4,6,7,8,9,10-octamethyl-5-(sulfanylmethyl)anthracen-1-yl]methanethiol |
|---|---|
| PubChem CID | 121337398 |
| Molecular Formula | C24H30S2 |
| Molecular Weight | 382.64 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | [2,3,4,6,7,8,9,10-octamethyl-5-(sulfanylmethyl)anthracen-1-yl]methanethiol |
| SMILES | Cc1c(C)c(CS)c2c(C)c3c(C)c(C)c(C)c(CS)c3c(C)c2c1C |
| InChI | InChI=1S/C24H30S2/c1-11-13(3)19(9-25)23-18(8)22-16(6)12(2)14(4)20(10-26)24(22)17(7)21(23)15(11)5/h25-26H,9-10H2,1-8H3 |
| InChIKey | UJNGOIVYSSRTQH-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.64 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|