C40H48O4S8 — CID 121337437
7,15,33,35-tetramethoxy-23,31,37,39-tetramethyl-3,4,11,12,19,20,27,28-octathiapentacyclo[28.2.2.26,9.214,17.222,25]tetraconta-1(33),6,8,14,16,22(36),23,25(35),30(34),31,37,39-dodecaene (PubChem CID 121337437) has the molecular formula C40H48O4S8 and a molecular weight of 849.36 g/mol. Its IUPAC name is 7,15,33,35-tetramethoxy-23,31,37,39-tetramethyl-3,4,11,12,19,20,27,28-octathiapentacyclo[28.2.2.26,9.214,17.222,25]tetraconta-1(33),6,8,14,16,22(36),23,25(35),30(34),31,37,39-dodecaene.
| Compound Name | 7,15,33,35-tetramethoxy-23,31,37,39-tetramethyl-3,4,11,12,19,20,27,28-octathiapentacyclo[28.2.2.26,9.214,17.222,25]tetraconta-1(33),6,8,14,16,22(36),23,25(35),30(34),31,37,39-dodecaene |
|---|---|
| PubChem CID | 121337437 |
| Molecular Formula | C40H48O4S8 |
| Molecular Weight | 849.36 g/mol |
| Exact Mass | 848.13 |
| IUPAC Name | 7,15,33,35-tetramethoxy-23,31,37,39-tetramethyl-3,4,11,12,19,20,27,28-octathiapentacyclo[28.2.2.26,9.214,17.222,25]tetraconta-1(33),6,8,14,16,22(36),23,25(35),30(34),31,37,39-dodecaene |
| SMILES | COc1cc2c(C)cc1CSSCc1cc(OC)c(cc1C)CSSCc1cc(C)c(cc1OC)CSSCc1cc(C)c(cc1OC)CSSC2 |
| InChI | InChI=1S/C40H48O4S8/c1-25-9-33-21-49-47-19-31-15-39(43-7)35(11-27(31)3)23-51-52-24-36-12-28(4)32(16-40(36)44-8)20-48-50-22-34-10-26(2)30(14-38(34)42-6)18-46-45-17-29(25)13-37(33)41-5/h9-16H,17-24H2,1-8H3 |
| InChIKey | OHCPGJASSHJAMO-UHFFFAOYSA-N |
| XLogP | 13.59 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.36 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|