C20H24O2S2 — CID 121337465
6,15-dimethoxy-13,17-dimethyl-3,10-dithiatricyclo[10.2.2.25,8]octadeca-1(15),5,7,12(16),13,17-hexaene (PubChem CID 121337465) has the molecular formula C20H24O2S2 and a molecular weight of 360.54 g/mol. Its IUPAC name is 6,15-dimethoxy-13,17-dimethyl-3,10-dithiatricyclo[10.2.2.25,8]octadeca-1(15),5,7,12(16),13,17-hexaene.
| Compound Name | 6,15-dimethoxy-13,17-dimethyl-3,10-dithiatricyclo[10.2.2.25,8]octadeca-1(15),5,7,12(16),13,17-hexaene |
|---|---|
| PubChem CID | 121337465 |
| Molecular Formula | C20H24O2S2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 6,15-dimethoxy-13,17-dimethyl-3,10-dithiatricyclo[10.2.2.25,8]octadeca-1(15),5,7,12(16),13,17-hexaene |
| SMILES | COc1cc2c(C)cc1CSCc1cc(C)c(cc1OC)CSC2 |
| InChI | InChI=1S/C20H24O2S2/c1-13-5-17-11-24-12-18-6-14(2)16(8-20(18)22-4)10-23-9-15(13)7-19(17)21-3/h5-8H,9-12H2,1-4H3 |
| InChIKey | ULSCBGGOLGEVJB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |