C20H23NO6 — CID 121338075
3-[[(4S,4aR,7aS,12bR)-4a-hydroxy-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy]propanoic acid (PubChem CID 121338075) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is 3-[[(4S,4aR,7aS,12bR)-4a-hydroxy-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy]propanoic acid.
| Compound Name | 3-[[(4S,4aR,7aS,12bR)-4a-hydroxy-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy]propanoic acid |
|---|---|
| PubChem CID | 121338075 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 3-[[(4S,4aR,7aS,12bR)-4a-hydroxy-3-methyl-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl]oxy]propanoic acid |
| SMILES | CN1CC[C@@]23c4c5ccc(OCCC(=O)O)c4O[C@@H]2C(=O)CC[C@]3(O)[C@@H]1C5 |
| InChI | InChI=1S/C20H23NO6/c1-21-8-7-19-16-11-2-3-13(26-9-5-15(23)24)17(16)27-18(19)12(22)4-6-20(19,25)14(21)10-11/h2-3,14,18,25H,4-10H2,1H3,(H,23,24)/t14-,18+,19+,20-/m0/s1 |
| InChIKey | PCRLDVHHIJBJHE-PSAKCFHXSA-N |
| XLogP | 0.89 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |