C13H24O3 — CID 121338921
(2S)-3-[(2R,3R,4R,5S)-4-ethyl-3-methyl-5-prop-2-enyloxolan-2-yl]propane-1,2-diol (PubChem CID 121338921) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is (2S)-3-[(2R,3R,4R,5S)-4-ethyl-3-methyl-5-prop-2-enyloxolan-2-yl]propane-1,2-diol.
| Compound Name | (2S)-3-[(2R,3R,4R,5S)-4-ethyl-3-methyl-5-prop-2-enyloxolan-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 121338921 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (2S)-3-[(2R,3R,4R,5S)-4-ethyl-3-methyl-5-prop-2-enyloxolan-2-yl]propane-1,2-diol |
| SMILES | C=CC[C@@H]1O[C@H](C[C@H](O)CO)[C@H](C)[C@H]1CC |
| InChI | InChI=1S/C13H24O3/c1-4-6-12-11(5-2)9(3)13(16-12)7-10(15)8-14/h4,9-15H,1,5-8H2,2-3H3/t9-,10+,11-,12+,13-/m1/s1 |
| InChIKey | UJLSZTHABDZTGW-RXGFPQBGSA-N |
| XLogP | 1.74 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|