C25H34N4O4 — CID 121339066
(2,5-dioxopyrrolidin-1-yl) 2-[[2-methyl-3-(4-methylpiperidin-1-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 121339066) has the molecular formula C25H34N4O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[[2-methyl-3-(4-methylpiperidin-1-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[[2-methyl-3-(4-methylpiperidin-1-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 121339066 |
| Molecular Formula | C25H34N4O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[[2-methyl-3-(4-methylpiperidin-1-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | Cc1c(CN2CC3CN(C(=O)ON4C(=O)CCC4=O)CC3C2)cccc1N1CCC(C)CC1 |
| InChI | InChI=1S/C25H34N4O4/c1-17-8-10-27(11-9-17)22-5-3-4-19(18(22)2)12-26-13-20-15-28(16-21(20)14-26)25(32)33-29-23(30)6-7-24(29)31/h3-5,17,20-21H,6-16H2,1-2H3 |
| InChIKey | WEZPDYIPLPPMOZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|