C13H18BrFN2O3 — CID 121339610
tert-butyl N-[(4-bromo-3-fluoro-2-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate (PubChem CID 121339610) has the molecular formula C13H18BrFN2O3 and a molecular weight of 349.20 g/mol. Its IUPAC name is tert-butyl N-[(4-bromo-3-fluoro-2-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate.
| Compound Name | tert-butyl N-[(4-bromo-3-fluoro-2-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate |
|---|---|
| PubChem CID | 121339610 |
| Molecular Formula | C13H18BrFN2O3 |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | tert-butyl N-[(4-bromo-3-fluoro-2-pyridinyl)methyl]-N-(2-hydroxyethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCO)Cc1nccc(Br)c1F |
| InChI | InChI=1S/C13H18BrFN2O3/c1-13(2,3)20-12(19)17(6-7-18)8-10-11(15)9(14)4-5-16-10/h4-5,18H,6-8H2,1-3H3 |
| InChIKey | GHJGIXSRVPNUSN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |