About tert-butyl 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]hex-5-enoate
tert-butyl 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]hex-5-enoate (PubChem CID 121340176) has the molecular formula C23H37N3O2
and a molecular weight of 387.57 g/mol. Its IUPAC name is tert-butyl 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]hex-5-enoate.
Molecular Properties
| Compound Name | tert-butyl 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]hex-5-enoate |
| PubChem CID | 121340176 |
| Molecular Formula | C23H37N3O2 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | tert-butyl 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]hex-5-enoate |
| SMILES | C=CCC(CC(=O)OC(C)(C)C)c1nnc(C2CC(CC(C)C)C2)n1C1CC1 |
| InChI | InChI=1S/C23H37N3O2/c1-7-8-17(14-20(27)28-23(4,5)6)21-24-25-22(26(21)19-9-10-19)18-12-16(13-18)11-15(2)3/h7,15-19H,1,8-14H2,2-6H3 |
| InChIKey | PBYDFYHJWJCPKV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]hex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]hex-5-enoate?
The IUPAC name of tert-butyl 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]hex-5-enoate (CID 121340176) is tert-butyl 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]hex-5-enoate.
What is the SMILES notation for tert-butyl 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]hex-5-enoate?
The canonical SMILES for tert-butyl 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]hex-5-enoate is C=CCC(CC(=O)OC(C)(C)C)c1nnc(C2CC(CC(C)C)C2)n1C1CC1.
What is the InChIKey of tert-butyl 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]hex-5-enoate?
The InChIKey is PBYDFYHJWJCPKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H37N3O2/c1-7-8-17(14-20(27)28-23(4,5)6)21-24-25-22(26(21)19-9-10-19)18-12-16(13-18)11-15(2)3/h7,15-19H,1,8-14H2,2-6H3.
What are the key properties of tert-butyl 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]hex-5-enoate?
tert-butyl 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]hex-5-enoate has a molecular weight of 387.57 g/mol, XLogP of 5.54, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]hex-5-enoate is sourced from PubChem (CID 121340176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).