About tert-butyl 3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]propanoate
tert-butyl 3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]propanoate (PubChem CID 121340361) has the molecular formula C11H17NO4
and a molecular weight of 227.26 g/mol. Its IUPAC name is tert-butyl 3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]propanoate.
Molecular Properties
| Compound Name | tert-butyl 3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]propanoate |
| PubChem CID | 121340361 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | tert-butyl 3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCc1cc(CO)on1 |
| InChI | InChI=1S/C11H17NO4/c1-11(2,3)15-10(14)5-4-8-6-9(7-13)16-12-8/h6,13H,4-5,7H2,1-3H3 |
| InChIKey | LOKVNGNEYUQHCA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]propanoate?
The IUPAC name of tert-butyl 3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]propanoate (CID 121340361) is tert-butyl 3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]propanoate.
What is the SMILES notation for tert-butyl 3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]propanoate?
The canonical SMILES for tert-butyl 3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]propanoate is CC(C)(C)OC(=O)CCc1cc(CO)on1.
What is the InChIKey of tert-butyl 3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]propanoate?
The InChIKey is LOKVNGNEYUQHCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO4/c1-11(2,3)15-10(14)5-4-8-6-9(7-13)16-12-8/h6,13H,4-5,7H2,1-3H3.
What are the key properties of tert-butyl 3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]propanoate?
tert-butyl 3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]propanoate has a molecular weight of 227.26 g/mol, XLogP of 1.44, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]propanoate is sourced from PubChem (CID 121340361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).