C21H17ClN2S — CID 121341237
2-(5-chlorothiophen-2-yl)-N-(4-prop-2-ynylphenyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine (PubChem CID 121341237) has the molecular formula C21H17ClN2S and a molecular weight of 364.90 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-(4-prop-2-ynylphenyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-(4-prop-2-ynylphenyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine |
|---|---|
| PubChem CID | 121341237 |
| Molecular Formula | C21H17ClN2S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-(4-prop-2-ynylphenyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-4-amine |
| SMILES | C#CCc1ccc(Nc2cc(-c3ccc(Cl)s3)nc3c2CCC3)cc1 |
| InChI | InChI=1S/C21H17ClN2S/c1-2-4-14-7-9-15(10-8-14)23-18-13-19(20-11-12-21(22)25-20)24-17-6-3-5-16(17)18/h1,7-13H,3-6H2,(H,23,24) |
| InChIKey | QEMFHKJEXHTKRU-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|