C22H18ClN3O2 — CID 121342339
4-[(3-chlorophenyl)methylamino]-6-(2-methoxy-3-pyridinyl)-1H-quinolin-2-one (PubChem CID 121342339) has the molecular formula C22H18ClN3O2 and a molecular weight of 391.86 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methylamino]-6-(2-methoxy-3-pyridinyl)-1H-quinolin-2-one.
| Compound Name | 4-[(3-chlorophenyl)methylamino]-6-(2-methoxy-3-pyridinyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 121342339 |
| Molecular Formula | C22H18ClN3O2 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 4-[(3-chlorophenyl)methylamino]-6-(2-methoxy-3-pyridinyl)-1H-quinolin-2-one |
| SMILES | COc1ncccc1-c1ccc2[nH]c(=O)cc(NCc3cccc(Cl)c3)c2c1 |
| InChI | InChI=1S/C22H18ClN3O2/c1-28-22-17(6-3-9-24-22)15-7-8-19-18(11-15)20(12-21(27)26-19)25-13-14-4-2-5-16(23)10-14/h2-12H,13H2,1H3,(H2,25,26,27) |
| InChIKey | ICRKRTSBMFYDHJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |