C18H18F5N5O — CID 121342592
N-[3-[(2R,3S,5R)-6-amino-3,5-difluoro-2,5-dimethyl-3,4-dihydropyridin-2-yl]-4-fluorophenyl]-1-(difluoromethyl)pyrazole-3-carboxamide (PubChem CID 121342592) has the molecular formula C18H18F5N5O and a molecular weight of 415.37 g/mol. Its IUPAC name is N-[3-[(2R,3S,5R)-6-amino-3,5-difluoro-2,5-dimethyl-3,4-dihydropyridin-2-yl]-4-fluorophenyl]-1-(difluoromethyl)pyrazole-3-carboxamide.
| Compound Name | N-[3-[(2R,3S,5R)-6-amino-3,5-difluoro-2,5-dimethyl-3,4-dihydropyridin-2-yl]-4-fluorophenyl]-1-(difluoromethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 121342592 |
| Molecular Formula | C18H18F5N5O |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-[3-[(2R,3S,5R)-6-amino-3,5-difluoro-2,5-dimethyl-3,4-dihydropyridin-2-yl]-4-fluorophenyl]-1-(difluoromethyl)pyrazole-3-carboxamide |
| SMILES | C[C@@]1(F)C[C@H](F)[C@@](C)(c2cc(NC(=O)c3ccn(C(F)F)n3)ccc2F)N=C1N |
| InChI | InChI=1S/C18H18F5N5O/c1-17(23)8-13(20)18(2,26-15(17)24)10-7-9(3-4-11(10)19)25-14(29)12-5-6-28(27-12)16(21)22/h3-7,13,16H,8H2,1-2H3,(H2,24,26)(H,25,29)/t13-,17+,18+/m0/s1 |
| InChIKey | WXDMVGSXLBQAFT-MORSLUCNSA-N |
| XLogP | 3.71 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |